C30H34O5Si — CID 23726556
(3S,4S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(1S)-3-oxo-1-phenylmethoxybutyl]oxetan-2-one (PubChem CID 23726556) has the molecular formula C30H34O5Si and a molecular weight of 502.68 g/mol. Its IUPAC name is (3S,4S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(1S)-3-oxo-1-phenylmethoxybutyl]oxetan-2-one.
| Compound Name | (3S,4S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(1S)-3-oxo-1-phenylmethoxybutyl]oxetan-2-one |
|---|---|
| PubChem CID | 23726556 |
| Molecular Formula | C30H34O5Si |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | (3S,4S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(1S)-3-oxo-1-phenylmethoxybutyl]oxetan-2-one |
| SMILES | CC(=O)C[C@H](OCc1ccccc1)[C@@H]1OC(=O)[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H34O5Si/c1-22(31)20-26(33-21-23-14-8-5-9-15-23)27-28(29(32)34-27)35-36(30(2,3)4,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-19,26-28H,20-21H2,1-4H3/t26-,27-,28-/m0/s1 |
| InChIKey | OVHOALUYXMUKLD-KCHLEUMXSA-N |
| XLogP | 4.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|