C14H22O9S — CID 11122112
[(3aR,4R,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] methanesulfonate (PubChem CID 11122112) has the molecular formula C14H22O9S and a molecular weight of 366.39 g/mol. Its IUPAC name is [(3aR,4R,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] methanesulfonate.
| Compound Name | [(3aR,4R,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] methanesulfonate |
|---|---|
| PubChem CID | 11122112 |
| Molecular Formula | C14H22O9S |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | [(3aR,4R,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] methanesulfonate |
| SMILES | CC1(C)O[C@H]2[C@@H]([C@H]3COC(C)(C)O3)OC(=O)[C@H](OS(C)(=O)=O)[C@H]2O1 |
| InChI | InChI=1S/C14H22O9S/c1-13(2)18-6-7(20-13)8-9-10(22-14(3,4)21-9)11(12(15)19-8)23-24(5,16)17/h7-11H,6H2,1-5H3/t7-,8-,9+,10+,11-/m1/s1 |
| InChIKey | WTTUPVHKYXDLKN-SAVGLBRCSA-N |
| XLogP | -0.07 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|