C15H30O6Si2 — CID 18664174
(4aR,7R,8S,8aR)-2,2-dimethyl-7,8-bis(trimethylsilyloxy)-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-one (PubChem CID 18664174) has the molecular formula C15H30O6Si2 and a molecular weight of 362.57 g/mol. Its IUPAC name is (4aR,7R,8S,8aR)-2,2-dimethyl-7,8-bis(trimethylsilyloxy)-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-one.
| Compound Name | (4aR,7R,8S,8aR)-2,2-dimethyl-7,8-bis(trimethylsilyloxy)-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-one |
|---|---|
| PubChem CID | 18664174 |
| Molecular Formula | C15H30O6Si2 |
| Molecular Weight | 362.57 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (4aR,7R,8S,8aR)-2,2-dimethyl-7,8-bis(trimethylsilyloxy)-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-one |
| SMILES | CC1(C)OC[C@H]2OC(=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O1 |
| InChI | InChI=1S/C15H30O6Si2/c1-15(2)17-9-10-11(19-15)12(20-22(3,4)5)13(14(16)18-10)21-23(6,7)8/h10-13H,9H2,1-8H3/t10-,11-,12+,13-/m1/s1 |
| InChIKey | QWQRQKHPSCQONA-FVCCEPFGSA-N |
| XLogP | 2.50 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.57 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|