C21H42O6Si2 — CID 14103109
(3R,4S,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-2-one (PubChem CID 14103109) has the molecular formula C21H42O6Si2 and a molecular weight of 446.73 g/mol. Its IUPAC name is (3R,4S,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-2-one.
| Compound Name | (3R,4S,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-2-one |
|---|---|
| PubChem CID | 14103109 |
| Molecular Formula | C21H42O6Si2 |
| Molecular Weight | 446.73 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | (3R,4S,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-2-one |
| SMILES | CC1(C)OC[C@H]([C@@H]2OC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C21H42O6Si2/c1-19(2,3)28(9,10)26-16-15(14-13-23-21(7,8)25-14)24-18(22)17(16)27-29(11,12)20(4,5)6/h14-17H,13H2,1-12H3/t14-,15+,16+,17-/m1/s1 |
| InChIKey | WLEGOSFUHSRCDC-LTIDMASMSA-N |
| XLogP | 4.84 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.73 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|