C26H50O7Si2 — CID 101029047
[(2S,3R,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-prop-2-enyloxolan-2-yl] acetate (PubChem CID 101029047) has the molecular formula C26H50O7Si2 and a molecular weight of 530.85 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-prop-2-enyloxolan-2-yl] acetate.
| Compound Name | [(2S,3R,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-prop-2-enyloxolan-2-yl] acetate |
|---|---|
| PubChem CID | 101029047 |
| Molecular Formula | C26H50O7Si2 |
| Molecular Weight | 530.85 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | [(2S,3R,4S,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-prop-2-enyloxolan-2-yl] acetate |
| SMILES | C=CC[C@@]1(OC(C)=O)O[C@H]([C@H]2COC(C)(C)O2)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O7Si2/c1-15-16-26(29-18(2)27)22(33-35(13,14)24(6,7)8)21(32-34(11,12)23(3,4)5)20(31-26)19-17-28-25(9,10)30-19/h15,19-22H,1,16-17H2,2-14H3/t19-,20-,21+,22-,26-/m1/s1 |
| InChIKey | NYIPCSSPNFOWTC-YTMMVNBISA-N |
| XLogP | 6.15 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.85 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|