C15H28O7Si — CID 10904185
(3aR,4S,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-carboxylic acid (PubChem CID 10904185) has the molecular formula C15H28O7Si and a molecular weight of 348.47 g/mol. Its IUPAC name is (3aR,4S,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-carboxylic acid.
| Compound Name | (3aR,4S,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-carboxylic acid |
|---|---|
| PubChem CID | 10904185 |
| Molecular Formula | C15H28O7Si |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (3aR,4S,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-carboxylic acid |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2C(=O)O |
| InChI | InChI=1S/C15H28O7Si/c1-14(2,3)23(6,7)22-11-9-8(20-15(4,5)21-9)10(12(16)17)19-13(11)18/h8-11,13,18H,1-7H3,(H,16,17)/t8-,9+,10+,11-,13?/m1/s1 |
| InChIKey | BMYITQAKYVSWRW-LPGFFSAWSA-N |
| XLogP | 1.70 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|