C25H54O7Si3 — CID 166001717
methyl (2S,3R,4S,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxyoxane-2-carboxylate (PubChem CID 166001717) has the molecular formula C25H54O7Si3 and a molecular weight of 550.96 g/mol. Its IUPAC name is methyl (2S,3R,4S,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3R,4S,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 166001717 |
| Molecular Formula | C25H54O7Si3 |
| Molecular Weight | 550.96 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | methyl (2S,3R,4S,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1OC(O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H54O7Si3/c1-23(2,3)33(11,12)30-17-18(31-34(13,14)24(4,5)6)20(32-35(15,16)25(7,8)9)22(27)29-19(17)21(26)28-10/h17-20,22,27H,1-16H3/t17-,18-,19-,20+,22?/m0/s1 |
| InChIKey | OWKLLGMYEOWARX-FTXGJLNKSA-N |
| XLogP | 6.05 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.96 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|