C38H73FO8Si4 — CID 68981319
methyl (2S,3S,4S,5R,6S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-fluorophenoxy]oxane-2-carboxylate (PubChem CID 68981319) has the molecular formula C38H73FO8Si4 and a molecular weight of 789.34 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-fluorophenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-fluorophenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 68981319 |
| Molecular Formula | C38H73FO8Si4 |
| Molecular Weight | 789.34 g/mol |
| Exact Mass | 788.44 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-fluorophenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc(CO[Si](C)(C)C(C)(C)C)cc2F)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H73FO8Si4/c1-35(2,3)48(14,15)42-25-26-22-23-28(27(39)24-26)43-34-32(47-51(20,21)38(10,11)12)30(46-50(18,19)37(7,8)9)29(31(44-34)33(40)41-13)45-49(16,17)36(4,5)6/h22-24,29-32,34H,25H2,1-21H3/t29-,30+,31+,32-,34-/m1/s1 |
| InChIKey | ZNDPOESVNNPPMG-BWMDDLPLSA-N |
| XLogP | 10.80 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.34 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|