C37H73NO9Si4 — CID 146034100
[3-nitro-4-[(2S,3R,5S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]oxyphenyl]methanol (PubChem CID 146034100) has the molecular formula C37H73NO9Si4 and a molecular weight of 788.33 g/mol. Its IUPAC name is [3-nitro-4-[(2S,3R,5S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]oxyphenyl]methanol.
| Compound Name | [3-nitro-4-[(2S,3R,5S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]oxyphenyl]methanol |
|---|---|
| PubChem CID | 146034100 |
| Molecular Formula | C37H73NO9Si4 |
| Molecular Weight | 788.33 g/mol |
| Exact Mass | 787.44 |
| IUPAC Name | [3-nitro-4-[(2S,3R,5S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]oxyphenyl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OCC1O[C@@H](Oc2ccc(CO)cc2[N+](=O)[O-])[C@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H73NO9Si4/c1-34(2,3)48(13,14)42-25-29-30(45-49(15,16)35(4,5)6)31(46-50(17,18)36(7,8)9)32(47-51(19,20)37(10,11)12)33(44-29)43-28-22-21-26(24-39)23-27(28)38(40)41/h21-23,29-33,39H,24-25H2,1-20H3/t29?,30-,31?,32+,33+/m0/s1 |
| InChIKey | PHTKUDTTYBVCRL-MDPHXYNQSA-N |
| XLogP | 10.38 |
| TPSA | 118.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.33 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|