C21H33NO5Si — CID 140905054
tert-butyl-dimethyl-[[3-nitro-4-[(1S,2S)-2-prop-2-enoxycyclopentyl]oxyphenyl]methoxy]silane (PubChem CID 140905054) has the molecular formula C21H33NO5Si and a molecular weight of 407.58 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[3-nitro-4-[(1S,2S)-2-prop-2-enoxycyclopentyl]oxyphenyl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[3-nitro-4-[(1S,2S)-2-prop-2-enoxycyclopentyl]oxyphenyl]methoxy]silane |
|---|---|
| PubChem CID | 140905054 |
| Molecular Formula | C21H33NO5Si |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | tert-butyl-dimethyl-[[3-nitro-4-[(1S,2S)-2-prop-2-enoxycyclopentyl]oxyphenyl]methoxy]silane |
| SMILES | C=CCO[C@H]1CCC[C@@H]1Oc1ccc(CO[Si](C)(C)C(C)(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H33NO5Si/c1-7-13-25-19-9-8-10-20(19)27-18-12-11-16(14-17(18)22(23)24)15-26-28(5,6)21(2,3)4/h7,11-12,14,19-20H,1,8-10,13,15H2,2-6H3/t19-,20-/m0/s1 |
| InChIKey | FUXCAQSDXLPGKK-PMACEKPBSA-N |
| XLogP | 5.62 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|