C16H19NO6 — CID 126650502
methyl 3-nitro-4-[(1S,2S)-2-prop-2-enoxycyclopentyl]oxybenzoate (PubChem CID 126650502) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is methyl 3-nitro-4-[(1S,2S)-2-prop-2-enoxycyclopentyl]oxybenzoate.
| Compound Name | methyl 3-nitro-4-[(1S,2S)-2-prop-2-enoxycyclopentyl]oxybenzoate |
|---|---|
| PubChem CID | 126650502 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | methyl 3-nitro-4-[(1S,2S)-2-prop-2-enoxycyclopentyl]oxybenzoate |
| SMILES | C=CCO[C@H]1CCC[C@@H]1Oc1ccc(C(=O)OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19NO6/c1-3-9-22-14-5-4-6-15(14)23-13-8-7-11(16(18)21-2)10-12(13)17(19)20/h3,7-8,10,14-15H,1,4-6,9H2,2H3/t14-,15-/m0/s1 |
| InChIKey | GEQZNQKUKMLASH-GJZGRUSLSA-N |
| XLogP | 2.88 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|