C15H21NO10 — CID 158777690
methanol;methyl 4-[(2S,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-nitrobenzoate (PubChem CID 158777690) has the molecular formula C15H21NO10 and a molecular weight of 375.33 g/mol. Its IUPAC name is methanol;methyl 4-[(2S,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-nitrobenzoate.
| Compound Name | methanol;methyl 4-[(2S,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 158777690 |
| Molecular Formula | C15H21NO10 |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | methanol;methyl 4-[(2S,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3-nitrobenzoate |
| SMILES | CO.COC(=O)c1ccc(O[C@H]2C[C@@H](O)[C@H](O)C(CO)O2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H17NO9.CH4O/c1-22-14(19)7-2-3-10(8(4-7)15(20)21)23-12-5-9(17)13(18)11(6-16)24-12;1-2/h2-4,9,11-13,16-18H,5-6H2,1H3;2H,1H3/t9-,11?,12-,13+;/m1./s1 |
| InChIKey | IQRGFDZJIYSSPB-VLASPLLRSA-N |
| XLogP | -0.80 |
| TPSA | 168.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|