C13H17NO7 — CID 143086876
5-amino-2-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoic acid (PubChem CID 143086876) has the molecular formula C13H17NO7 and a molecular weight of 299.28 g/mol. Its IUPAC name is 5-amino-2-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoic acid.
| Compound Name | 5-amino-2-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 143086876 |
| Molecular Formula | C13H17NO7 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 5-amino-2-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoic acid |
| SMILES | Nc1ccc(OC2CC(O)C(O)C(CO)O2)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H17NO7/c14-6-1-2-9(7(3-6)13(18)19)20-11-4-8(16)12(17)10(5-15)21-11/h1-3,8,10-12,15-17H,4-5,14H2,(H,18,19) |
| InChIKey | VKTLFZQYJMNFNR-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|