C18H21NO5 — CID 163726855
(3S,4R,6S)-6-(2-anilinophenoxy)-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 163726855) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is (3S,4R,6S)-6-(2-anilinophenoxy)-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (3S,4R,6S)-6-(2-anilinophenoxy)-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 163726855 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (3S,4R,6S)-6-(2-anilinophenoxy)-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | OCC1O[C@@H](Oc2ccccc2Nc2ccccc2)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H21NO5/c20-11-16-18(22)14(21)10-17(24-16)23-15-9-5-4-8-13(15)19-12-6-2-1-3-7-12/h1-9,14,16-22H,10-11H2/t14-,16?,17-,18+/m1/s1 |
| InChIKey | KWIRBDZUWOVEKU-CCNLRDMRSA-N |
| XLogP | 1.64 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |