C27H38O7Si — CID 11060198
methyl (2R,3S,4R,5R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3,4-bis(phenylmethoxy)oxane-2-carboxylate (PubChem CID 11060198) has the molecular formula C27H38O7Si and a molecular weight of 502.68 g/mol. Its IUPAC name is methyl (2R,3S,4R,5R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3,4-bis(phenylmethoxy)oxane-2-carboxylate.
| Compound Name | methyl (2R,3S,4R,5R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3,4-bis(phenylmethoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 11060198 |
| Molecular Formula | C27H38O7Si |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | methyl (2R,3S,4R,5R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3,4-bis(phenylmethoxy)oxane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H38O7Si/c1-27(2,3)35(5,6)34-26-21(28)22(31-17-19-13-9-7-10-14-19)23(24(33-26)25(29)30-4)32-18-20-15-11-8-12-16-20/h7-16,21-24,26,28H,17-18H2,1-6H3/t21-,22-,23+,24-,26-/m1/s1 |
| InChIKey | PBOYPCLXWOVVBF-HROMDODWSA-N |
| XLogP | 4.44 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|