C24H41NO6Si — CID 11397197
tert-butyl N-[(1R,2S,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-2-phenylmethoxycyclohexyl]carbamate (PubChem CID 11397197) has the molecular formula C24H41NO6Si and a molecular weight of 467.68 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-2-phenylmethoxycyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-2-phenylmethoxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 11397197 |
| Molecular Formula | C24H41NO6Si |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | tert-butyl N-[(1R,2S,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-2-phenylmethoxycyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@@H](O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C24H41NO6Si/c1-23(2,3)30-22(28)25-17-14-18(26)19(27)21(31-32(7,8)24(4,5)6)20(17)29-15-16-12-10-9-11-13-16/h9-13,17-21,26-27H,14-15H2,1-8H3,(H,25,28)/t17-,18-,19-,20+,21+/m1/s1 |
| InChIKey | DBYCKFLIBHPVLQ-XKRYSZRTSA-N |
| XLogP | 3.98 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|