C18H25NO5 — CID 122212288
tert-butyl N-[(3R,3aS,4R,6aR)-4-phenylmethoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-3-yl]carbamate (PubChem CID 122212288) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is tert-butyl N-[(3R,3aS,4R,6aR)-4-phenylmethoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,3aS,4R,6aR)-4-phenylmethoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-3-yl]carbamate |
|---|---|
| PubChem CID | 122212288 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | tert-butyl N-[(3R,3aS,4R,6aR)-4-phenylmethoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CO[C@@H]2OC[C@H](OCc3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C18H25NO5/c1-18(2,3)24-17(20)19-13-10-22-16-15(13)14(11-23-16)21-9-12-7-5-4-6-8-12/h4-8,13-16H,9-11H2,1-3H3,(H,19,20)/t13-,14-,15-,16+/m0/s1 |
| InChIKey | KSPWBVNOEQDNJR-YHUYYLMFSA-N |
| XLogP | 2.47 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |