C21H31NO4 — CID 166168690
tert-butyl N-(8-phenylmethoxy-1-oxaspiro[4.5]decan-3-yl)carbamate (PubChem CID 166168690) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is tert-butyl N-(8-phenylmethoxy-1-oxaspiro[4.5]decan-3-yl)carbamate.
| Compound Name | tert-butyl N-(8-phenylmethoxy-1-oxaspiro[4.5]decan-3-yl)carbamate |
|---|---|
| PubChem CID | 166168690 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | tert-butyl N-(8-phenylmethoxy-1-oxaspiro[4.5]decan-3-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1COC2(CCC(OCc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C21H31NO4/c1-20(2,3)26-19(23)22-17-13-21(25-15-17)11-9-18(10-12-21)24-14-16-7-5-4-6-8-16/h4-8,17-18H,9-15H2,1-3H3,(H,22,23) |
| InChIKey | BTIAOIDJKOVMEI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |