C21H34FNO4 — CID 144830570
tert-butyl N-[(2R)-1-fluoro-3-hydroxypropan-2-yl]carbamate;cyclohexyloxymethylbenzene (PubChem CID 144830570) has the molecular formula C21H34FNO4 and a molecular weight of 383.50 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-fluoro-3-hydroxypropan-2-yl]carbamate;cyclohexyloxymethylbenzene.
| Compound Name | tert-butyl N-[(2R)-1-fluoro-3-hydroxypropan-2-yl]carbamate;cyclohexyloxymethylbenzene |
|---|---|
| PubChem CID | 144830570 |
| Molecular Formula | C21H34FNO4 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | tert-butyl N-[(2R)-1-fluoro-3-hydroxypropan-2-yl]carbamate;cyclohexyloxymethylbenzene |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)CF.c1ccc(COC2CCCCC2)cc1 |
| InChI | InChI=1S/C13H18O.C8H16FNO3/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13;1-8(2,3)13-7(12)10-6(4-9)5-11/h1,3-4,7-8,13H,2,5-6,9-11H2;6,11H,4-5H2,1-3H3,(H,10,12)/t;6-/m.0/s1 |
| InChIKey | FUDNXHYOYZLUJR-ZCMDIHMWSA-N |
| XLogP | 4.38 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |