C14H17NO5 — CID 141150025
(3-phenylmethoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl) carbamate (PubChem CID 141150025) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is (3-phenylmethoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl) carbamate.
| Compound Name | (3-phenylmethoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl) carbamate |
|---|---|
| PubChem CID | 141150025 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | (3-phenylmethoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl) carbamate |
| SMILES | NC(=O)OC1COC2OCC(OCc3ccccc3)C12 |
| InChI | InChI=1S/C14H17NO5/c15-14(16)20-11-8-19-13-12(11)10(7-18-13)17-6-9-4-2-1-3-5-9/h1-5,10-13H,6-8H2,(H2,15,16) |
| InChIKey | YYSJKHZSXKAZMD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |