C13H16O4 — CID 134857022
[(3R)-3-phenylmethoxyoxolan-2-yl] acetate (PubChem CID 134857022) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is [(3R)-3-phenylmethoxyoxolan-2-yl] acetate.
| Compound Name | [(3R)-3-phenylmethoxyoxolan-2-yl] acetate |
|---|---|
| PubChem CID | 134857022 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | [(3R)-3-phenylmethoxyoxolan-2-yl] acetate |
| SMILES | CC(=O)OC1OCC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C13H16O4/c1-10(14)17-13-12(7-8-15-13)16-9-11-5-3-2-4-6-11/h2-6,12-13H,7-9H2,1H3/t12-,13?/m1/s1 |
| InChIKey | ICUJZRPQSOYWSL-PZORYLMUSA-N |
| XLogP | 1.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |