C16H20O6 — CID 23271774
(3-acetyloxy-2-phenylmethoxyoxan-4-yl) acetate (PubChem CID 23271774) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is (3-acetyloxy-2-phenylmethoxyoxan-4-yl) acetate.
| Compound Name | (3-acetyloxy-2-phenylmethoxyoxan-4-yl) acetate |
|---|---|
| PubChem CID | 23271774 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (3-acetyloxy-2-phenylmethoxyoxan-4-yl) acetate |
| SMILES | CC(=O)OC1CCOC(OCc2ccccc2)C1OC(C)=O |
| InChI | InChI=1S/C16H20O6/c1-11(17)21-14-8-9-19-16(15(14)22-12(2)18)20-10-13-6-4-3-5-7-13/h3-7,14-16H,8-10H2,1-2H3 |
| InChIKey | PZCCHBKLPBYLRJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |