C21H22O5 — CID 162664103
8,9-bis(phenylmethoxy)-2,6-dioxabicyclo[3.3.1]nonan-3-one (PubChem CID 162664103) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is 8,9-bis(phenylmethoxy)-2,6-dioxabicyclo[3.3.1]nonan-3-one.
| Compound Name | 8,9-bis(phenylmethoxy)-2,6-dioxabicyclo[3.3.1]nonan-3-one |
|---|---|
| PubChem CID | 162664103 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 8,9-bis(phenylmethoxy)-2,6-dioxabicyclo[3.3.1]nonan-3-one |
| SMILES | O=C1CC2OCC(OCc3ccccc3)C(O1)C2OCc1ccccc1 |
| InChI | InChI=1S/C21H22O5/c22-19-11-17-20(25-13-16-9-5-2-6-10-16)21(26-19)18(14-24-17)23-12-15-7-3-1-4-8-15/h1-10,17-18,20-21H,11-14H2 |
| InChIKey | BTBPVKOLASACLG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |