C14H16O4S — CID 71505779
(3aS,6S,7R,7aS)-6-hydroxy-7-phenylmethoxy-3,3a,5,6,7,7a-hexahydrothiopyrano[3,2-b]furan-2-one (PubChem CID 71505779) has the molecular formula C14H16O4S and a molecular weight of 280.34 g/mol. Its IUPAC name is (3aS,6S,7R,7aS)-6-hydroxy-7-phenylmethoxy-3,3a,5,6,7,7a-hexahydrothiopyrano[3,2-b]furan-2-one.
| Compound Name | (3aS,6S,7R,7aS)-6-hydroxy-7-phenylmethoxy-3,3a,5,6,7,7a-hexahydrothiopyrano[3,2-b]furan-2-one |
|---|---|
| PubChem CID | 71505779 |
| Molecular Formula | C14H16O4S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (3aS,6S,7R,7aS)-6-hydroxy-7-phenylmethoxy-3,3a,5,6,7,7a-hexahydrothiopyrano[3,2-b]furan-2-one |
| SMILES | O=C1C[C@@H]2SC[C@@H](O)[C@@H](OCc3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C14H16O4S/c15-10-8-19-11-6-12(16)18-14(11)13(10)17-7-9-4-2-1-3-5-9/h1-5,10-11,13-15H,6-8H2/t10-,11+,13-,14-/m1/s1 |
| InChIKey | ARFFQLHGCNIQMN-ZMJPVWNMSA-N |
| XLogP | 1.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |