C28H29NO4 — CID 15545459
(3aS,6S,7R,7aR)-4-benzyl-6,7-bis(phenylmethoxy)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridin-2-one (PubChem CID 15545459) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is (3aS,6S,7R,7aR)-4-benzyl-6,7-bis(phenylmethoxy)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridin-2-one.
| Compound Name | (3aS,6S,7R,7aR)-4-benzyl-6,7-bis(phenylmethoxy)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridin-2-one |
|---|---|
| PubChem CID | 15545459 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | (3aS,6S,7R,7aR)-4-benzyl-6,7-bis(phenylmethoxy)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridin-2-one |
| SMILES | O=C1C[C@H]2[C@@H](O1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)CN2Cc1ccccc1 |
| InChI | InChI=1S/C28H29NO4/c30-26-16-24-27(33-26)28(32-20-23-14-8-3-9-15-23)25(31-19-22-12-6-2-7-13-22)18-29(24)17-21-10-4-1-5-11-21/h1-15,24-25,27-28H,16-20H2/t24-,25-,27+,28+/m0/s1 |
| InChIKey | FYXNODXNMCARLX-RQNVWYSMSA-N |
| XLogP | 4.36 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |