C27H26O5 — CID 102030110
(2R,3R,3aS,6aR)-3-phenylmethoxy-2-[(R)-phenyl(phenylmethoxy)methyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one (PubChem CID 102030110) has the molecular formula C27H26O5 and a molecular weight of 430.50 g/mol. Its IUPAC name is (2R,3R,3aS,6aR)-3-phenylmethoxy-2-[(R)-phenyl(phenylmethoxy)methyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one.
| Compound Name | (2R,3R,3aS,6aR)-3-phenylmethoxy-2-[(R)-phenyl(phenylmethoxy)methyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 102030110 |
| Molecular Formula | C27H26O5 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (2R,3R,3aS,6aR)-3-phenylmethoxy-2-[(R)-phenyl(phenylmethoxy)methyl]-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
| SMILES | O=C1C[C@H]2O[C@H]([C@H](OCc3ccccc3)c3ccccc3)[C@@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C27H26O5/c28-23-16-22-25(32-23)26(30-18-20-12-6-2-7-13-20)27(31-22)24(21-14-8-3-9-15-21)29-17-19-10-4-1-5-11-19/h1-15,22,24-27H,16-18H2/t22-,24-,25+,26+,27-/m1/s1 |
| InChIKey | ZMHYETBEEMKOPB-VUDMOXGKSA-N |
| XLogP | 4.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |