C19H18O3 — CID 10402189
(3R,3aR,6aR)-2-benzyl-3-phenyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one (PubChem CID 10402189) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is (3R,3aR,6aR)-2-benzyl-3-phenyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one.
| Compound Name | (3R,3aR,6aR)-2-benzyl-3-phenyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 10402189 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (3R,3aR,6aR)-2-benzyl-3-phenyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
| SMILES | O=C1C[C@H]2OC(Cc3ccccc3)[C@@H](c3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C19H18O3/c20-17-12-16-19(22-17)18(14-9-5-2-6-10-14)15(21-16)11-13-7-3-1-4-8-13/h1-10,15-16,18-19H,11-12H2/t15?,16-,18-,19+/m1/s1 |
| InChIKey | SMWTWEFIWAJOGB-MHGPCZNRSA-N |
| XLogP | 3.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |