C17H16O3S — CID 10447536
(3S,3aR,6aR)-2-benzyl-3-thiophen-2-yl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one (PubChem CID 10447536) has the molecular formula C17H16O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is (3S,3aR,6aR)-2-benzyl-3-thiophen-2-yl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one.
| Compound Name | (3S,3aR,6aR)-2-benzyl-3-thiophen-2-yl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 10447536 |
| Molecular Formula | C17H16O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | (3S,3aR,6aR)-2-benzyl-3-thiophen-2-yl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
| SMILES | O=C1C[C@H]2OC(Cc3ccccc3)[C@H](c3cccs3)[C@H]2O1 |
| InChI | InChI=1S/C17H16O3S/c18-15-10-13-17(20-15)16(14-7-4-8-21-14)12(19-13)9-11-5-2-1-3-6-11/h1-8,12-13,16-17H,9-10H2/t12?,13-,16-,17+/m1/s1 |
| InChIKey | DQIYZWPSLLKXFO-JFOKOBIRSA-N |
| XLogP | 3.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |