C9H8O4S — CID 97034970
(2S,3S)-5-oxo-2-thiophen-2-yloxolane-3-carboxylic acid (PubChem CID 97034970) has the molecular formula C9H8O4S and a molecular weight of 212.23 g/mol. Its IUPAC name is (2S,3S)-5-oxo-2-thiophen-2-yloxolane-3-carboxylic acid.
| Compound Name | (2S,3S)-5-oxo-2-thiophen-2-yloxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 97034970 |
| Molecular Formula | C9H8O4S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | (2S,3S)-5-oxo-2-thiophen-2-yloxolane-3-carboxylic acid |
| SMILES | O=C1C[C@H](C(=O)O)[C@@H](c2cccs2)O1 |
| InChI | InChI=1S/C9H8O4S/c10-7-4-5(9(11)12)8(13-7)6-2-1-3-14-6/h1-3,5,8H,4H2,(H,11,12)/t5-,8-/m0/s1 |
| InChIKey | ZLFREXCVVVWOMR-XNCJUZBTSA-N |
| XLogP | 1.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |