C9H9BrO2S — CID 134965227
(5R,6S)-5-bromo-6-thiophen-2-yloxan-2-one (PubChem CID 134965227) has the molecular formula C9H9BrO2S and a molecular weight of 261.14 g/mol. Its IUPAC name is (5R,6S)-5-bromo-6-thiophen-2-yloxan-2-one.
| Compound Name | (5R,6S)-5-bromo-6-thiophen-2-yloxan-2-one |
|---|---|
| PubChem CID | 134965227 |
| Molecular Formula | C9H9BrO2S |
| Molecular Weight | 261.14 g/mol |
| Exact Mass | 259.95 |
| IUPAC Name | (5R,6S)-5-bromo-6-thiophen-2-yloxan-2-one |
| SMILES | O=C1CC[C@@H](Br)[C@H](c2cccs2)O1 |
| InChI | InChI=1S/C9H9BrO2S/c10-6-3-4-8(11)12-9(6)7-2-1-5-13-7/h1-2,5-6,9H,3-4H2/t6-,9-/m1/s1 |
| InChIKey | PQKCVRKFBVVTBX-HZGVNTEJSA-N |
| XLogP | 2.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.14 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|