C13H10O2S2 — CID 101204695
(4S,5R)-3-methylidene-4,5-dithiophen-2-yloxolan-2-one (PubChem CID 101204695) has the molecular formula C13H10O2S2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (4S,5R)-3-methylidene-4,5-dithiophen-2-yloxolan-2-one.
| Compound Name | (4S,5R)-3-methylidene-4,5-dithiophen-2-yloxolan-2-one |
|---|---|
| PubChem CID | 101204695 |
| Molecular Formula | C13H10O2S2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | (4S,5R)-3-methylidene-4,5-dithiophen-2-yloxolan-2-one |
| SMILES | C=C1C(=O)O[C@@H](c2cccs2)[C@H]1c1cccs1 |
| InChI | InChI=1S/C13H10O2S2/c1-8-11(9-4-2-6-16-9)12(15-13(8)14)10-5-3-7-17-10/h2-7,11-12H,1H2/t11-,12+/m1/s1 |
| InChIKey | AKLJNLOSZKGOHZ-NEPJUHHUSA-N |
| XLogP | 3.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|