C7H5NO2S2 — CID 21271225
2-sulfanylidene-5-thiophen-2-yl-1,3-oxazolidin-4-one (PubChem CID 21271225) has the molecular formula C7H5NO2S2 and a molecular weight of 199.26 g/mol. Its IUPAC name is 2-sulfanylidene-5-thiophen-2-yl-1,3-oxazolidin-4-one.
| Compound Name | 2-sulfanylidene-5-thiophen-2-yl-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 21271225 |
| Molecular Formula | C7H5NO2S2 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 198.98 |
| IUPAC Name | 2-sulfanylidene-5-thiophen-2-yl-1,3-oxazolidin-4-one |
| SMILES | O=C1NC(=S)OC1c1cccs1 |
| InChI | InChI=1S/C7H5NO2S2/c9-6-5(10-7(11)8-6)4-2-1-3-12-4/h1-3,5H,(H,8,9,11) |
| InChIKey | HAHJMOGXTBMEEG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|