C14H10N2O2S2 — CID 77153151
1,4-dithiophen-2-yl-1,2,4,5-tetrahydropyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 77153151) has the molecular formula C14H10N2O2S2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1,4-dithiophen-2-yl-1,2,4,5-tetrahydropyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 1,4-dithiophen-2-yl-1,2,4,5-tetrahydropyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 77153151 |
| Molecular Formula | C14H10N2O2S2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 1,4-dithiophen-2-yl-1,2,4,5-tetrahydropyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | O=C1NC(c2cccs2)C2=C1C(c1cccs1)NC2=O |
| InChI | InChI=1S/C14H10N2O2S2/c17-13-9-10(12(16-13)8-4-2-6-20-8)14(18)15-11(9)7-3-1-5-19-7/h1-6,11-12H,(H,15,18)(H,16,17) |
| InChIKey | GNVQHHWMUSCKQW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |