C8H9NO2S — CID 10749971
(3R,4R)-3-hydroxy-3-methyl-4-thiophen-2-ylazetidin-2-one (PubChem CID 10749971) has the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. Its IUPAC name is (3R,4R)-3-hydroxy-3-methyl-4-thiophen-2-ylazetidin-2-one.
| Compound Name | (3R,4R)-3-hydroxy-3-methyl-4-thiophen-2-ylazetidin-2-one |
|---|---|
| PubChem CID | 10749971 |
| Molecular Formula | C8H9NO2S |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | (3R,4R)-3-hydroxy-3-methyl-4-thiophen-2-ylazetidin-2-one |
| SMILES | C[C@]1(O)C(=O)N[C@H]1c1cccs1 |
| InChI | InChI=1S/C8H9NO2S/c1-8(11)6(9-7(8)10)5-3-2-4-12-5/h2-4,6,11H,1H3,(H,9,10)/t6-,8+/m0/s1 |
| InChIKey | FDQWAEZDEIKLFY-POYBYMJQSA-N |
| XLogP | 0.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |