C8H8O3S — CID 123672356
2-methyl-3-thiophen-2-yloxirane-2-carboxylic acid (PubChem CID 123672356) has the molecular formula C8H8O3S and a molecular weight of 184.22 g/mol. Its IUPAC name is 2-methyl-3-thiophen-2-yloxirane-2-carboxylic acid.
| Compound Name | 2-methyl-3-thiophen-2-yloxirane-2-carboxylic acid |
|---|---|
| PubChem CID | 123672356 |
| Molecular Formula | C8H8O3S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | 2-methyl-3-thiophen-2-yloxirane-2-carboxylic acid |
| SMILES | CC1(C(=O)O)OC1c1cccs1 |
| InChI | InChI=1S/C8H8O3S/c1-8(7(9)10)6(11-8)5-3-2-4-12-5/h2-4,6H,1H3,(H,9,10) |
| InChIKey | RREMISBWSFNDNL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|