C9H13NOS — CID 19930546
2,2-dimethyl-5-thiophen-2-yl-1,3-oxazolidine (PubChem CID 19930546) has the molecular formula C9H13NOS and a molecular weight of 183.28 g/mol. Its IUPAC name is 2,2-dimethyl-5-thiophen-2-yl-1,3-oxazolidine.
| Compound Name | 2,2-dimethyl-5-thiophen-2-yl-1,3-oxazolidine |
|---|---|
| PubChem CID | 19930546 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 2,2-dimethyl-5-thiophen-2-yl-1,3-oxazolidine |
| SMILES | CC1(C)NCC(c2cccs2)O1 |
| InChI | InChI=1S/C9H13NOS/c1-9(2)10-6-7(11-9)8-4-3-5-12-8/h3-5,7,10H,6H2,1-2H3 |
| InChIKey | VFXYOVMPHZCCJZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |