C10H9NO2S — CID 82377314
2-thiophen-2-yl-3,4-dihydro-2H-furo[3,4-b][1,4]oxazine (PubChem CID 82377314) has the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. Its IUPAC name is 2-thiophen-2-yl-3,4-dihydro-2H-furo[3,4-b][1,4]oxazine.
| Compound Name | 2-thiophen-2-yl-3,4-dihydro-2H-furo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 82377314 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 2-thiophen-2-yl-3,4-dihydro-2H-furo[3,4-b][1,4]oxazine |
| SMILES | c1csc(C2CNc3cocc3O2)c1 |
| InChI | InChI=1S/C10H9NO2S/c1-2-10(14-3-1)8-4-11-7-5-12-6-9(7)13-8/h1-3,5-6,8,11H,4H2 |
| InChIKey | NWPTVMCXIWYXFT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |