C12H11BrN2S — CID 115285777
7-bromo-2-thiophen-2-yl-1,2,3,4-tetrahydroquinoxaline (PubChem CID 115285777) has the molecular formula C12H11BrN2S and a molecular weight of 295.21 g/mol. Its IUPAC name is 7-bromo-2-thiophen-2-yl-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | 7-bromo-2-thiophen-2-yl-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 115285777 |
| Molecular Formula | C12H11BrN2S |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | 7-bromo-2-thiophen-2-yl-1,2,3,4-tetrahydroquinoxaline |
| SMILES | Brc1ccc2c(c1)NC(c1cccs1)CN2 |
| InChI | InChI=1S/C12H11BrN2S/c13-8-3-4-9-10(6-8)15-11(7-14-9)12-2-1-5-16-12/h1-6,11,14-15H,7H2 |
| InChIKey | LXSNEDMPJTXJME-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |