C12H10F2N2S — CID 115285794
7,8-difluoro-2-thiophen-2-yl-1,2,3,4-tetrahydroquinoxaline (PubChem CID 115285794) has the molecular formula C12H10F2N2S and a molecular weight of 252.29 g/mol. Its IUPAC name is 7,8-difluoro-2-thiophen-2-yl-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | 7,8-difluoro-2-thiophen-2-yl-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 115285794 |
| Molecular Formula | C12H10F2N2S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 7,8-difluoro-2-thiophen-2-yl-1,2,3,4-tetrahydroquinoxaline |
| SMILES | Fc1ccc2c(c1F)NC(c1cccs1)CN2 |
| InChI | InChI=1S/C12H10F2N2S/c13-7-3-4-8-12(11(7)14)16-9(6-15-8)10-2-1-5-17-10/h1-5,9,15-16H,6H2 |
| InChIKey | VQCTUDVWTIUVSL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |