C13H13NS — CID 3980200
7-methyl-2-thiophen-2-yl-2,3-dihydro-1H-indole (PubChem CID 3980200) has the molecular formula C13H13NS and a molecular weight of 215.32 g/mol. Its IUPAC name is 7-methyl-2-thiophen-2-yl-2,3-dihydro-1H-indole.
| Compound Name | 7-methyl-2-thiophen-2-yl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 3980200 |
| Molecular Formula | C13H13NS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 7-methyl-2-thiophen-2-yl-2,3-dihydro-1H-indole |
| SMILES | Cc1cccc2c1NC(c1cccs1)C2 |
| InChI | InChI=1S/C13H13NS/c1-9-4-2-5-10-8-11(14-13(9)10)12-6-3-7-15-12/h2-7,11,14H,8H2,1H3 |
| InChIKey | VTBXSSYETWWGKM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |