C15H17NS — CID 4556277
7-propan-2-yl-2-thiophen-2-yl-2,3-dihydro-1H-indole (PubChem CID 4556277) has the molecular formula C15H17NS and a molecular weight of 243.38 g/mol. Its IUPAC name is 7-propan-2-yl-2-thiophen-2-yl-2,3-dihydro-1H-indole.
| Compound Name | 7-propan-2-yl-2-thiophen-2-yl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 4556277 |
| Molecular Formula | C15H17NS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 7-propan-2-yl-2-thiophen-2-yl-2,3-dihydro-1H-indole |
| SMILES | CC(C)c1cccc2c1NC(c1cccs1)C2 |
| InChI | InChI=1S/C15H17NS/c1-10(2)12-6-3-5-11-9-13(16-15(11)12)14-7-4-8-17-14/h3-8,10,13,16H,9H2,1-2H3 |
| InChIKey | NGDVIJDDMAESAJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |