C13H12ClNS — CID 3618708
6-chloro-7-methyl-2-thiophen-2-yl-2,3-dihydro-1H-indole (PubChem CID 3618708) has the molecular formula C13H12ClNS and a molecular weight of 249.77 g/mol. Its IUPAC name is 6-chloro-7-methyl-2-thiophen-2-yl-2,3-dihydro-1H-indole.
| Compound Name | 6-chloro-7-methyl-2-thiophen-2-yl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 3618708 |
| Molecular Formula | C13H12ClNS |
| Molecular Weight | 249.77 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 6-chloro-7-methyl-2-thiophen-2-yl-2,3-dihydro-1H-indole |
| SMILES | Cc1c(Cl)ccc2c1NC(c1cccs1)C2 |
| InChI | InChI=1S/C13H12ClNS/c1-8-10(14)5-4-9-7-11(15-13(8)9)12-3-2-6-16-12/h2-6,11,15H,7H2,1H3 |
| InChIKey | MVJHPSSZIBGYFV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.77 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |