About (2R)-7-methyl-2-(trifluoromethyl)-2,3-dihydro-1H-indole
(2R)-7-methyl-2-(trifluoromethyl)-2,3-dihydro-1H-indole (PubChem CID 130642989) has the molecular formula C10H10F3N
and a molecular weight of 201.19 g/mol. Its IUPAC name is (2R)-7-methyl-2-(trifluoromethyl)-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | (2R)-7-methyl-2-(trifluoromethyl)-2,3-dihydro-1H-indole |
| PubChem CID | 130642989 |
| Molecular Formula | C10H10F3N |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | (2R)-7-methyl-2-(trifluoromethyl)-2,3-dihydro-1H-indole |
| SMILES | Cc1cccc2c1N[C@@H](C(F)(F)F)C2 |
| InChI | InChI=1S/C10H10F3N/c1-6-3-2-4-7-5-8(10(11,12)13)14-9(6)7/h2-4,8,14H,5H2,1H3/t8-/m1/s1 |
| InChIKey | NLDJOTUHFARHKJ-MRVPVSSYSA-N |
| XLogP | 2.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-7-methyl-2-(trifluoromethyl)-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-7-methyl-2-(trifluoromethyl)-2,3-dihydro-1H-indole?
The IUPAC name of (2R)-7-methyl-2-(trifluoromethyl)-2,3-dihydro-1H-indole (CID 130642989) is (2R)-7-methyl-2-(trifluoromethyl)-2,3-dihydro-1H-indole.
What is the SMILES notation for (2R)-7-methyl-2-(trifluoromethyl)-2,3-dihydro-1H-indole?
The canonical SMILES for (2R)-7-methyl-2-(trifluoromethyl)-2,3-dihydro-1H-indole is Cc1cccc2c1N[C@@H](C(F)(F)F)C2.
What is the InChIKey of (2R)-7-methyl-2-(trifluoromethyl)-2,3-dihydro-1H-indole?
The InChIKey is NLDJOTUHFARHKJ-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H10F3N/c1-6-3-2-4-7-5-8(10(11,12)13)14-9(6)7/h2-4,8,14H,5H2,1H3/t8-/m1/s1.
What are the key properties of (2R)-7-methyl-2-(trifluoromethyl)-2,3-dihydro-1H-indole?
(2R)-7-methyl-2-(trifluoromethyl)-2,3-dihydro-1H-indole has a molecular weight of 201.19 g/mol, XLogP of 2.89, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-7-methyl-2-(trifluoromethyl)-2,3-dihydro-1H-indole is sourced from PubChem (CID 130642989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).