C9H7ClF3N — CID 130682483
(2R)-7-chloro-2-(trifluoromethyl)-2,3-dihydro-1H-indole (PubChem CID 130682483) has the molecular formula C9H7ClF3N and a molecular weight of 221.61 g/mol. Its IUPAC name is (2R)-7-chloro-2-(trifluoromethyl)-2,3-dihydro-1H-indole.
| Compound Name | (2R)-7-chloro-2-(trifluoromethyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 130682483 |
| Molecular Formula | C9H7ClF3N |
| Molecular Weight | 221.61 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | (2R)-7-chloro-2-(trifluoromethyl)-2,3-dihydro-1H-indole |
| SMILES | FC(F)(F)[C@H]1Cc2cccc(Cl)c2N1 |
| InChI | InChI=1S/C9H7ClF3N/c10-6-3-1-2-5-4-7(9(11,12)13)14-8(5)6/h1-3,7,14H,4H2/t7-/m1/s1 |
| InChIKey | AJDOKJYBMSEQQZ-SSDOTTSWSA-N |
| XLogP | 3.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.61 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |