C10H12ClNO — CID 83880243
(8-chloro-1,2,3,4-tetrahydroquinolin-2-yl)methanol (PubChem CID 83880243) has the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. Its IUPAC name is (8-chloro-1,2,3,4-tetrahydroquinolin-2-yl)methanol.
| Compound Name | (8-chloro-1,2,3,4-tetrahydroquinolin-2-yl)methanol |
|---|---|
| PubChem CID | 83880243 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | (8-chloro-1,2,3,4-tetrahydroquinolin-2-yl)methanol |
| SMILES | OCC1CCc2cccc(Cl)c2N1 |
| InChI | InChI=1S/C10H12ClNO/c11-9-3-1-2-7-4-5-8(6-13)12-10(7)9/h1-3,8,12-13H,4-6H2 |
| InChIKey | LFPBRKYKRZUZLJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |