C12H17NO2 — CID 83883204
8-methoxy-2-(methoxymethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 83883204) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 8-methoxy-2-(methoxymethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 8-methoxy-2-(methoxymethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 83883204 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 8-methoxy-2-(methoxymethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | COCC1CCc2cccc(OC)c2N1 |
| InChI | InChI=1S/C12H17NO2/c1-14-8-10-7-6-9-4-3-5-11(15-2)12(9)13-10/h3-5,10,13H,6-8H2,1-2H3 |
| InChIKey | LVMWHOQHQYMIQZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |