C10H11ClO2 — CID 134294877
(1R,2S)-8-chloro-1,2,3,4-tetrahydronaphthalene-1,2-diol (PubChem CID 134294877) has the molecular formula C10H11ClO2 and a molecular weight of 198.65 g/mol. Its IUPAC name is (1R,2S)-8-chloro-1,2,3,4-tetrahydronaphthalene-1,2-diol.
| Compound Name | (1R,2S)-8-chloro-1,2,3,4-tetrahydronaphthalene-1,2-diol |
|---|---|
| PubChem CID | 134294877 |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | (1R,2S)-8-chloro-1,2,3,4-tetrahydronaphthalene-1,2-diol |
| SMILES | O[C@@H]1c2c(Cl)cccc2CC[C@@H]1O |
| InChI | InChI=1S/C10H11ClO2/c11-7-3-1-2-6-4-5-8(12)10(13)9(6)7/h1-3,8,10,12-13H,4-5H2/t8-,10-/m0/s1 |
| InChIKey | UKIHDHRASWCPMF-WPRPVWTQSA-N |
| XLogP | 1.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |