C11H10ClNO — CID 83833988
8-chloro-1-isocyanato-1,2,3,4-tetrahydronaphthalene (PubChem CID 83833988) has the molecular formula C11H10ClNO and a molecular weight of 207.66 g/mol. Its IUPAC name is 8-chloro-1-isocyanato-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 8-chloro-1-isocyanato-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 83833988 |
| Molecular Formula | C11H10ClNO |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 8-chloro-1-isocyanato-1,2,3,4-tetrahydronaphthalene |
| SMILES | O=C=NC1CCCc2cccc(Cl)c21 |
| InChI | InChI=1S/C11H10ClNO/c12-9-5-1-3-8-4-2-6-10(11(8)9)13-7-14/h1,3,5,10H,2,4,6H2 |
| InChIKey | NYEBZSMTMFXHIF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|