About 1-(7-chloro-2,3-dihydro-1H-inden-1-yl)ethanamine
1-(7-chloro-2,3-dihydro-1H-inden-1-yl)ethanamine (PubChem CID 105449608) has the molecular formula C11H14ClN
and a molecular weight of 195.69 g/mol. Its IUPAC name is 1-(7-chloro-2,3-dihydro-1H-inden-1-yl)ethanamine.
Molecular Properties
| Compound Name | 1-(7-chloro-2,3-dihydro-1H-inden-1-yl)ethanamine |
| PubChem CID | 105449608 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 1-(7-chloro-2,3-dihydro-1H-inden-1-yl)ethanamine |
| SMILES | CC(N)C1CCc2cccc(Cl)c21 |
| InChI | InChI=1S/C11H14ClN/c1-7(13)9-6-5-8-3-2-4-10(12)11(8)9/h2-4,7,9H,5-6,13H2,1H3 |
| InChIKey | ZZERAUAWZUZXCH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(7-chloro-2,3-dihydro-1H-inden-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-chloro-2,3-dihydro-1H-inden-1-yl)ethanamine?
The IUPAC name of 1-(7-chloro-2,3-dihydro-1H-inden-1-yl)ethanamine (CID 105449608) is 1-(7-chloro-2,3-dihydro-1H-inden-1-yl)ethanamine.
What is the SMILES notation for 1-(7-chloro-2,3-dihydro-1H-inden-1-yl)ethanamine?
The canonical SMILES for 1-(7-chloro-2,3-dihydro-1H-inden-1-yl)ethanamine is CC(N)C1CCc2cccc(Cl)c21.
What is the InChIKey of 1-(7-chloro-2,3-dihydro-1H-inden-1-yl)ethanamine?
The InChIKey is ZZERAUAWZUZXCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClN/c1-7(13)9-6-5-8-3-2-4-10(12)11(8)9/h2-4,7,9H,5-6,13H2,1H3.
What are the key properties of 1-(7-chloro-2,3-dihydro-1H-inden-1-yl)ethanamine?
1-(7-chloro-2,3-dihydro-1H-inden-1-yl)ethanamine has a molecular weight of 195.69 g/mol, XLogP of 2.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-chloro-2,3-dihydro-1H-inden-1-yl)ethanamine is sourced from PubChem (CID 105449608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).