C11H14ClNO — CID 157083464
8-chloro-N-methoxy-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 157083464) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is 8-chloro-N-methoxy-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 8-chloro-N-methoxy-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 157083464 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 8-chloro-N-methoxy-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CONC1CCCc2cccc(Cl)c21 |
| InChI | InChI=1S/C11H14ClNO/c1-14-13-10-7-3-5-8-4-2-6-9(12)11(8)10/h2,4,6,10,13H,3,5,7H2,1H3 |
| InChIKey | WZDBHEUVZHKPGU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|